C12H6N4O5S — CID 168606623
5-sulfo-2-(1,2,2-tricyanoethenylamino)benzoic acid (PubChem CID 168606623) has the molecular formula C12H6N4O5S and a molecular weight of 318.27 g/mol. Its IUPAC name is 5-sulfo-2-(1,2,2-tricyanoethenylamino)benzoic acid.
| Compound Name | 5-sulfo-2-(1,2,2-tricyanoethenylamino)benzoic acid |
|---|---|
| PubChem CID | 168606623 |
| Molecular Formula | C12H6N4O5S |
| Molecular Weight | 318.27 g/mol |
| Exact Mass | 318.01 |
| IUPAC Name | 5-sulfo-2-(1,2,2-tricyanoethenylamino)benzoic acid |
| SMILES | N#CC(C#N)=C(C#N)Nc1ccc(S(=O)(=O)O)cc1C(=O)O |
| InChI | InChI=1S/C12H6N4O5S/c13-4-7(5-14)11(6-15)16-10-2-1-8(22(19,20)21)3-9(10)12(17)18/h1-3,16H,(H,17,18)(H,19,20,21) |
| InChIKey | XGKLKLCYTYSPTJ-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 175.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.27 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|