C12H5IN4O2 — CID 168609903
2-iodo-3-(1,2,2-tricyanoethenylamino)benzoic acid (PubChem CID 168609903) has the molecular formula C12H5IN4O2 and a molecular weight of 364.10 g/mol. Its IUPAC name is 2-iodo-3-(1,2,2-tricyanoethenylamino)benzoic acid.
| Compound Name | 2-iodo-3-(1,2,2-tricyanoethenylamino)benzoic acid |
|---|---|
| PubChem CID | 168609903 |
| Molecular Formula | C12H5IN4O2 |
| Molecular Weight | 364.10 g/mol |
| Exact Mass | 363.95 |
| IUPAC Name | 2-iodo-3-(1,2,2-tricyanoethenylamino)benzoic acid |
| SMILES | N#CC(C#N)=C(C#N)Nc1cccc(C(=O)O)c1I |
| InChI | InChI=1S/C12H5IN4O2/c13-11-8(12(18)19)2-1-3-9(11)17-10(6-16)7(4-14)5-15/h1-3,17H,(H,18,19) |
| InChIKey | SQQPUWXPUOLRMA-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 120.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.10 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|