C16H15N5O — CID 168609753
N,N-diethyl-2-(1,2,2-tricyanoethenylamino)benzamide (PubChem CID 168609753) has the molecular formula C16H15N5O and a molecular weight of 293.33 g/mol. Its IUPAC name is N,N-diethyl-2-(1,2,2-tricyanoethenylamino)benzamide.
| Compound Name | N,N-diethyl-2-(1,2,2-tricyanoethenylamino)benzamide |
|---|---|
| PubChem CID | 168609753 |
| Molecular Formula | C16H15N5O |
| Molecular Weight | 293.33 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | N,N-diethyl-2-(1,2,2-tricyanoethenylamino)benzamide |
| SMILES | CCN(CC)C(=O)c1ccccc1NC(C#N)=C(C#N)C#N |
| InChI | InChI=1S/C16H15N5O/c1-3-21(4-2)16(22)13-7-5-6-8-14(13)20-15(11-19)12(9-17)10-18/h5-8,20H,3-4H2,1-2H3 |
| InChIKey | BRSUUEPPHLZJEF-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 103.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.33 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|