C12H16N2O2 — CID 168652158
N,N-diethyl-2-formamidobenzamide (PubChem CID 168652158) has the molecular formula C12H16N2O2 and a molecular weight of 220.27 g/mol. Its IUPAC name is N,N-diethyl-2-formamidobenzamide.
| Compound Name | N,N-diethyl-2-formamidobenzamide |
|---|---|
| PubChem CID | 168652158 |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | N,N-diethyl-2-formamidobenzamide |
| SMILES | CCN(CC)C(=O)c1ccccc1NC=O |
| InChI | InChI=1S/C12H16N2O2/c1-3-14(4-2)12(16)10-7-5-6-8-11(10)13-9-15/h5-9H,3-4H2,1-2H3,(H,13,15) |
| InChIKey | JOPMYZPFKBOOLN-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|