C13H18N2O — CID 10932915
2-(ethenylamino)-N,N-diethylbenzamide (PubChem CID 10932915) has the molecular formula C13H18N2O and a molecular weight of 218.30 g/mol. Its IUPAC name is 2-(ethenylamino)-N,N-diethylbenzamide.
| Compound Name | 2-(ethenylamino)-N,N-diethylbenzamide |
|---|---|
| PubChem CID | 10932915 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | 2-(ethenylamino)-N,N-diethylbenzamide |
| SMILES | C=CNc1ccccc1C(=O)N(CC)CC |
| InChI | InChI=1S/C13H18N2O/c1-4-14-12-10-8-7-9-11(12)13(16)15(5-2)6-3/h4,7-10,14H,1,5-6H2,2-3H3 |
| InChIKey | GKARRGLKUVKLGA-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |