C10H12N2O2 — CID 64992505
2-formamido-N,N-dimethylbenzamide (PubChem CID 64992505) has the molecular formula C10H12N2O2 and a molecular weight of 192.22 g/mol. Its IUPAC name is 2-formamido-N,N-dimethylbenzamide.
| Compound Name | 2-formamido-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 64992505 |
| Molecular Formula | C10H12N2O2 |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | 2-formamido-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1ccccc1NC=O |
| InChI | InChI=1S/C10H12N2O2/c1-12(2)10(14)8-5-3-4-6-9(8)11-7-13/h3-7H,1-2H3,(H,11,13) |
| InChIKey | ZVGVIVROBBKRHX-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|