C11H13NO2 — CID 145181093
N,N-dimethyl-2-(2-oxoethyl)benzamide (PubChem CID 145181093) has the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. Its IUPAC name is N,N-dimethyl-2-(2-oxoethyl)benzamide.
| Compound Name | N,N-dimethyl-2-(2-oxoethyl)benzamide |
|---|---|
| PubChem CID | 145181093 |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | N,N-dimethyl-2-(2-oxoethyl)benzamide |
| SMILES | CN(C)C(=O)c1ccccc1CC=O |
| InChI | InChI=1S/C11H13NO2/c1-12(2)11(14)10-6-4-3-5-9(10)7-8-13/h3-6,8H,7H2,1-2H3 |
| InChIKey | DNDVDAWPILVGGH-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|