C16H17NO2 — CID 134022314
N,N-dimethyl-2-(phenoxymethyl)benzamide (PubChem CID 134022314) has the molecular formula C16H17NO2 and a molecular weight of 255.32 g/mol. Its IUPAC name is N,N-dimethyl-2-(phenoxymethyl)benzamide.
| Compound Name | N,N-dimethyl-2-(phenoxymethyl)benzamide |
|---|---|
| PubChem CID | 134022314 |
| Molecular Formula | C16H17NO2 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | N,N-dimethyl-2-(phenoxymethyl)benzamide |
| SMILES | CN(C)C(=O)c1ccccc1COc1ccccc1 |
| InChI | InChI=1S/C16H17NO2/c1-17(2)16(18)15-11-7-6-8-13(15)12-19-14-9-4-3-5-10-14/h3-11H,12H2,1-2H3 |
| InChIKey | USZNTDKVPKGYNJ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |