C23H20F2N2O3 — CID 167897883
N-[2-(3,5-difluoroanilino)-2-oxoethyl]-N-methyl-2-(phenoxymethyl)benzamide (PubChem CID 167897883) has the molecular formula C23H20F2N2O3 and a molecular weight of 410.42 g/mol. Its IUPAC name is N-[2-(3,5-difluoroanilino)-2-oxoethyl]-N-methyl-2-(phenoxymethyl)benzamide.
| Compound Name | N-[2-(3,5-difluoroanilino)-2-oxoethyl]-N-methyl-2-(phenoxymethyl)benzamide |
|---|---|
| PubChem CID | 167897883 |
| Molecular Formula | C23H20F2N2O3 |
| Molecular Weight | 410.42 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | N-[2-(3,5-difluoroanilino)-2-oxoethyl]-N-methyl-2-(phenoxymethyl)benzamide |
| SMILES | CN(CC(=O)Nc1cc(F)cc(F)c1)C(=O)c1ccccc1COc1ccccc1 |
| InChI | InChI=1S/C23H20F2N2O3/c1-27(14-22(28)26-19-12-17(24)11-18(25)13-19)23(29)21-10-6-5-7-16(21)15-30-20-8-3-2-4-9-20/h2-13H,14-15H2,1H3,(H,26,28) |
| InChIKey | IGJNFEKRLYYCAA-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.42 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |