C12H14N2O — CID 63953084
N,N-dimethyl-2-(prop-2-ynylamino)benzamide (PubChem CID 63953084) has the molecular formula C12H14N2O and a molecular weight of 202.26 g/mol. Its IUPAC name is N,N-dimethyl-2-(prop-2-ynylamino)benzamide.
| Compound Name | N,N-dimethyl-2-(prop-2-ynylamino)benzamide |
|---|---|
| PubChem CID | 63953084 |
| Molecular Formula | C12H14N2O |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | N,N-dimethyl-2-(prop-2-ynylamino)benzamide |
| SMILES | C#CCNc1ccccc1C(=O)N(C)C |
| InChI | InChI=1S/C12H14N2O/c1-4-9-13-11-8-6-5-7-10(11)12(15)14(2)3/h1,5-8,13H,9H2,2-3H3 |
| InChIKey | BTDZDOIYJWUQCM-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|