C16H17ClN2O2 — CID 115951452
2-[(3-chloro-2-hydroxyphenyl)methylamino]-N,N-dimethylbenzamide (PubChem CID 115951452) has the molecular formula C16H17ClN2O2 and a molecular weight of 304.78 g/mol. Its IUPAC name is 2-[(3-chloro-2-hydroxyphenyl)methylamino]-N,N-dimethylbenzamide.
| Compound Name | 2-[(3-chloro-2-hydroxyphenyl)methylamino]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 115951452 |
| Molecular Formula | C16H17ClN2O2 |
| Molecular Weight | 304.78 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | 2-[(3-chloro-2-hydroxyphenyl)methylamino]-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1ccccc1NCc1cccc(Cl)c1O |
| InChI | InChI=1S/C16H17ClN2O2/c1-19(2)16(21)12-7-3-4-9-14(12)18-10-11-6-5-8-13(17)15(11)20/h3-9,18,20H,10H2,1-2H3 |
| InChIKey | FZWDBBOUFLRRPK-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.78 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|