C9H11ClN2O2 — CID 88939329
3-(chloroamino)-2-hydroxy-N,N-dimethylbenzamide (PubChem CID 88939329) has the molecular formula C9H11ClN2O2 and a molecular weight of 214.65 g/mol. Its IUPAC name is 3-(chloroamino)-2-hydroxy-N,N-dimethylbenzamide.
| Compound Name | 3-(chloroamino)-2-hydroxy-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 88939329 |
| Molecular Formula | C9H11ClN2O2 |
| Molecular Weight | 214.65 g/mol |
| Exact Mass | 214.05 |
| IUPAC Name | 3-(chloroamino)-2-hydroxy-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1cccc(NCl)c1O |
| InChI | InChI=1S/C9H11ClN2O2/c1-12(2)9(14)6-4-3-5-7(11-10)8(6)13/h3-5,11,13H,1-2H3 |
| InChIKey | PKOOOADAYIVETJ-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.65 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|