C20H33N5O4 — CID 142262584
ethane;3-[[5-(ethylamino)-3,6-dioxo-1,2-dihydropyridazin-4-yl]amino]-2-hydroxy-N,N-dimethylbenzamide;propane (PubChem CID 142262584) has the molecular formula C20H33N5O4 and a molecular weight of 407.52 g/mol. Its IUPAC name is ethane;3-[[5-(ethylamino)-3,6-dioxo-1,2-dihydropyridazin-4-yl]amino]-2-hydroxy-N,N-dimethylbenzamide;propane.
| Compound Name | ethane;3-[[5-(ethylamino)-3,6-dioxo-1,2-dihydropyridazin-4-yl]amino]-2-hydroxy-N,N-dimethylbenzamide;propane |
|---|---|
| PubChem CID | 142262584 |
| Molecular Formula | C20H33N5O4 |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.25 |
| IUPAC Name | ethane;3-[[5-(ethylamino)-3,6-dioxo-1,2-dihydropyridazin-4-yl]amino]-2-hydroxy-N,N-dimethylbenzamide;propane |
| SMILES | CC.CCC.CCNc1c(Nc2cccc(C(=O)N(C)C)c2O)c(=O)[nH][nH]c1=O |
| InChI | InChI=1S/C15H19N5O4.C3H8.C2H6/c1-4-16-10-11(14(23)19-18-13(10)22)17-9-7-5-6-8(12(9)21)15(24)20(2)3;1-3-2;1-2/h5-7,21H,4H2,1-3H3,(H2,16,19,23)(H2,17,18,22);3H2,1-2H3;1-2H3 |
| InChIKey | SBHODJHRKIOBAV-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 130.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|