C23H33N5O5 — CID 142810409
4-[3-[[2-(ethylamino)-3,4-dioxocyclobuten-1-yl]amino]-2-hydroxybenzoyl]-N,N-dimethylpiperazine-1-carboxamide;propane (PubChem CID 142810409) has the molecular formula C23H33N5O5 and a molecular weight of 459.55 g/mol. Its IUPAC name is 4-[3-[[2-(ethylamino)-3,4-dioxocyclobuten-1-yl]amino]-2-hydroxybenzoyl]-N,N-dimethylpiperazine-1-carboxamide;propane.
| Compound Name | 4-[3-[[2-(ethylamino)-3,4-dioxocyclobuten-1-yl]amino]-2-hydroxybenzoyl]-N,N-dimethylpiperazine-1-carboxamide;propane |
|---|---|
| PubChem CID | 142810409 |
| Molecular Formula | C23H33N5O5 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.25 |
| IUPAC Name | 4-[3-[[2-(ethylamino)-3,4-dioxocyclobuten-1-yl]amino]-2-hydroxybenzoyl]-N,N-dimethylpiperazine-1-carboxamide;propane |
| SMILES | CCC.CCNc1c(Nc2cccc(C(=O)N3CCN(C(=O)N(C)C)CC3)c2O)c(=O)c1=O |
| InChI | InChI=1S/C20H25N5O5.C3H8/c1-4-21-14-15(18(28)17(14)27)22-13-7-5-6-12(16(13)26)19(29)24-8-10-25(11-9-24)20(30)23(2)3;1-3-2/h5-7,21-22,26H,4,8-11H2,1-3H3;3H2,1-2H3 |
| InChIKey | BDMFPFYGWKZMPK-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 122.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|