C26H27N3O6 — CID 58736707
1-[3-[[3,4-dioxo-2-[[(1R)-1-phenylpropyl]amino]cyclobuten-1-yl]amino]-2-hydroxybenzoyl]piperidine-4-carboxylic acid (PubChem CID 58736707) has the molecular formula C26H27N3O6 and a molecular weight of 477.52 g/mol. Its IUPAC name is 1-[3-[[3,4-dioxo-2-[[(1R)-1-phenylpropyl]amino]cyclobuten-1-yl]amino]-2-hydroxybenzoyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[3-[[3,4-dioxo-2-[[(1R)-1-phenylpropyl]amino]cyclobuten-1-yl]amino]-2-hydroxybenzoyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 58736707 |
| Molecular Formula | C26H27N3O6 |
| Molecular Weight | 477.52 g/mol |
| Exact Mass | 477.19 |
| IUPAC Name | 1-[3-[[3,4-dioxo-2-[[(1R)-1-phenylpropyl]amino]cyclobuten-1-yl]amino]-2-hydroxybenzoyl]piperidine-4-carboxylic acid |
| SMILES | CC[C@@H](Nc1c(Nc2cccc(C(=O)N3CCC(C(=O)O)CC3)c2O)c(=O)c1=O)c1ccccc1 |
| InChI | InChI=1S/C26H27N3O6/c1-2-18(15-7-4-3-5-8-15)27-20-21(24(32)23(20)31)28-19-10-6-9-17(22(19)30)25(33)29-13-11-16(12-14-29)26(34)35/h3-10,16,18,27-28,30H,2,11-14H2,1H3,(H,34,35)/t18-/m1/s1 |
| InChIKey | HLPQMYVRSNTANU-GOSISDBHSA-N |
| XLogP | 3.23 |
| TPSA | 136.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.52 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|