C21H20N2O5 — CID 88545400
3-[[3,4-dioxo-2-[[(1R)-1-phenylpropyl]amino]cyclobuten-1-yl]amino]-2-methoxybenzoic acid (PubChem CID 88545400) has the molecular formula C21H20N2O5 and a molecular weight of 380.40 g/mol. Its IUPAC name is 3-[[3,4-dioxo-2-[[(1R)-1-phenylpropyl]amino]cyclobuten-1-yl]amino]-2-methoxybenzoic acid.
| Compound Name | 3-[[3,4-dioxo-2-[[(1R)-1-phenylpropyl]amino]cyclobuten-1-yl]amino]-2-methoxybenzoic acid |
|---|---|
| PubChem CID | 88545400 |
| Molecular Formula | C21H20N2O5 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | 3-[[3,4-dioxo-2-[[(1R)-1-phenylpropyl]amino]cyclobuten-1-yl]amino]-2-methoxybenzoic acid |
| SMILES | CC[C@@H](Nc1c(Nc2cccc(C(=O)O)c2OC)c(=O)c1=O)c1ccccc1 |
| InChI | InChI=1S/C21H20N2O5/c1-3-14(12-8-5-4-6-9-12)22-16-17(19(25)18(16)24)23-15-11-7-10-13(21(26)27)20(15)28-2/h4-11,14,22-23H,3H2,1-2H3,(H,26,27)/t14-/m1/s1 |
| InChIKey | OZPFCQWTGXYURS-CQSZACIVSA-N |
| XLogP | 3.30 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|