C28H27N3O5 — CID 58736690
3-[[3,4-dioxo-2-[[(1R)-1-phenylpropyl]amino]cyclobuten-1-yl]amino]-N-ethyl-2-hydroxy-N-(3-hydroxyphenyl)benzamide (PubChem CID 58736690) has the molecular formula C28H27N3O5 and a molecular weight of 485.54 g/mol. Its IUPAC name is 3-[[3,4-dioxo-2-[[(1R)-1-phenylpropyl]amino]cyclobuten-1-yl]amino]-N-ethyl-2-hydroxy-N-(3-hydroxyphenyl)benzamide.
| Compound Name | 3-[[3,4-dioxo-2-[[(1R)-1-phenylpropyl]amino]cyclobuten-1-yl]amino]-N-ethyl-2-hydroxy-N-(3-hydroxyphenyl)benzamide |
|---|---|
| PubChem CID | 58736690 |
| Molecular Formula | C28H27N3O5 |
| Molecular Weight | 485.54 g/mol |
| Exact Mass | 485.20 |
| IUPAC Name | 3-[[3,4-dioxo-2-[[(1R)-1-phenylpropyl]amino]cyclobuten-1-yl]amino]-N-ethyl-2-hydroxy-N-(3-hydroxyphenyl)benzamide |
| SMILES | CC[C@@H](Nc1c(Nc2cccc(C(=O)N(CC)c3cccc(O)c3)c2O)c(=O)c1=O)c1ccccc1 |
| InChI | InChI=1S/C28H27N3O5/c1-3-21(17-10-6-5-7-11-17)29-23-24(27(35)26(23)34)30-22-15-9-14-20(25(22)33)28(36)31(4-2)18-12-8-13-19(32)16-18/h5-16,21,29-30,32-33H,3-4H2,1-2H3/t21-/m1/s1 |
| InChIKey | OVUDLHDUCJWGGH-OAQYLSRUSA-N |
| XLogP | 4.67 |
| TPSA | 118.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.54 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|