C25H25N3O7 — CID 58736438
4-[3-[[3,4-dioxo-2-[[(1R)-1-phenylpropyl]amino]cyclobuten-1-yl]amino]-2-hydroxybenzoyl]morpholine-2-carboxylic acid (PubChem CID 58736438) has the molecular formula C25H25N3O7 and a molecular weight of 479.49 g/mol. Its IUPAC name is 4-[3-[[3,4-dioxo-2-[[(1R)-1-phenylpropyl]amino]cyclobuten-1-yl]amino]-2-hydroxybenzoyl]morpholine-2-carboxylic acid.
| Compound Name | 4-[3-[[3,4-dioxo-2-[[(1R)-1-phenylpropyl]amino]cyclobuten-1-yl]amino]-2-hydroxybenzoyl]morpholine-2-carboxylic acid |
|---|---|
| PubChem CID | 58736438 |
| Molecular Formula | C25H25N3O7 |
| Molecular Weight | 479.49 g/mol |
| Exact Mass | 479.17 |
| IUPAC Name | 4-[3-[[3,4-dioxo-2-[[(1R)-1-phenylpropyl]amino]cyclobuten-1-yl]amino]-2-hydroxybenzoyl]morpholine-2-carboxylic acid |
| SMILES | CC[C@@H](Nc1c(Nc2cccc(C(=O)N3CCOC(C(=O)O)C3)c2O)c(=O)c1=O)c1ccccc1 |
| InChI | InChI=1S/C25H25N3O7/c1-2-16(14-7-4-3-5-8-14)26-19-20(23(31)22(19)30)27-17-10-6-9-15(21(17)29)24(32)28-11-12-35-18(13-28)25(33)34/h3-10,16,18,26-27,29H,2,11-13H2,1H3,(H,33,34)/t16-,18?/m1/s1 |
| InChIKey | SLZFVSVBXOZLCH-PYUWXLGESA-N |
| XLogP | 2.22 |
| TPSA | 145.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.49 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|