C27H31N3O5 — CID 58736729
3-[2-hydroxy-3-[2-(2-hydroxyethyl)piperidine-1-carbonyl]anilino]-4-[[(1R)-1-phenylpropyl]amino]cyclobut-3-ene-1,2-dione (PubChem CID 58736729) has the molecular formula C27H31N3O5 and a molecular weight of 477.56 g/mol. Its IUPAC name is 3-[2-hydroxy-3-[2-(2-hydroxyethyl)piperidine-1-carbonyl]anilino]-4-[[(1R)-1-phenylpropyl]amino]cyclobut-3-ene-1,2-dione.
| Compound Name | 3-[2-hydroxy-3-[2-(2-hydroxyethyl)piperidine-1-carbonyl]anilino]-4-[[(1R)-1-phenylpropyl]amino]cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 58736729 |
| Molecular Formula | C27H31N3O5 |
| Molecular Weight | 477.56 g/mol |
| Exact Mass | 477.23 |
| IUPAC Name | 3-[2-hydroxy-3-[2-(2-hydroxyethyl)piperidine-1-carbonyl]anilino]-4-[[(1R)-1-phenylpropyl]amino]cyclobut-3-ene-1,2-dione |
| SMILES | CC[C@@H](Nc1c(Nc2cccc(C(=O)N3CCCCC3CCO)c2O)c(=O)c1=O)c1ccccc1 |
| InChI | InChI=1S/C27H31N3O5/c1-2-20(17-9-4-3-5-10-17)28-22-23(26(34)25(22)33)29-21-13-8-12-19(24(21)32)27(35)30-15-7-6-11-18(30)14-16-31/h3-5,8-10,12-13,18,20,28-29,31-32H,2,6-7,11,14-16H2,1H3/t18?,20-/m1/s1 |
| InChIKey | IASZCVXOGPRHLB-ROPPNANJSA-N |
| XLogP | 3.67 |
| TPSA | 118.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.56 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|