C25H29N3O5 — CID 74319971
3-[3-(azetidine-1-carbonyl)-2-hydroxyanilino]-4-[1-(5-methyl-4-propan-2-ylfuran-2-yl)propylamino]cyclobut-3-ene-1,2-dione (PubChem CID 74319971) has the molecular formula C25H29N3O5 and a molecular weight of 451.52 g/mol. Its IUPAC name is 3-[3-(azetidine-1-carbonyl)-2-hydroxyanilino]-4-[1-(5-methyl-4-propan-2-ylfuran-2-yl)propylamino]cyclobut-3-ene-1,2-dione.
| Compound Name | 3-[3-(azetidine-1-carbonyl)-2-hydroxyanilino]-4-[1-(5-methyl-4-propan-2-ylfuran-2-yl)propylamino]cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 74319971 |
| Molecular Formula | C25H29N3O5 |
| Molecular Weight | 451.52 g/mol |
| Exact Mass | 451.21 |
| IUPAC Name | 3-[3-(azetidine-1-carbonyl)-2-hydroxyanilino]-4-[1-(5-methyl-4-propan-2-ylfuran-2-yl)propylamino]cyclobut-3-ene-1,2-dione |
| SMILES | CCC(Nc1c(Nc2cccc(C(=O)N3CCC3)c2O)c(=O)c1=O)c1cc(C(C)C)c(C)o1 |
| InChI | InChI=1S/C25H29N3O5/c1-5-17(19-12-16(13(2)3)14(4)33-19)26-20-21(24(31)23(20)30)27-18-9-6-8-15(22(18)29)25(32)28-10-7-11-28/h6,8-9,12-13,17,26-27,29H,5,7,10-11H2,1-4H3 |
| InChIKey | RWPVSUBUUQRZQN-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 111.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.52 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|