C21H19N3O4 — CID 59068176
3-anilino-4-[2-hydroxy-3-(pyrrolidine-1-carbonyl)anilino]cyclobut-3-ene-1,2-dione (PubChem CID 59068176) has the molecular formula C21H19N3O4 and a molecular weight of 377.40 g/mol. Its IUPAC name is 3-anilino-4-[2-hydroxy-3-(pyrrolidine-1-carbonyl)anilino]cyclobut-3-ene-1,2-dione.
| Compound Name | 3-anilino-4-[2-hydroxy-3-(pyrrolidine-1-carbonyl)anilino]cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 59068176 |
| Molecular Formula | C21H19N3O4 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | 3-anilino-4-[2-hydroxy-3-(pyrrolidine-1-carbonyl)anilino]cyclobut-3-ene-1,2-dione |
| SMILES | O=C(c1cccc(Nc2c(Nc3ccccc3)c(=O)c2=O)c1O)N1CCCC1 |
| InChI | InChI=1S/C21H19N3O4/c25-18-14(21(28)24-11-4-5-12-24)9-6-10-15(18)23-17-16(19(26)20(17)27)22-13-7-2-1-3-8-13/h1-3,6-10,22-23,25H,4-5,11-12H2 |
| InChIKey | UOJGOGXENGEXQR-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|