C27H24N4O5S — CID 142857004
3-(benzylamino)-4-[2-hydroxy-3-[4-(thiophene-2-carbonyl)piperazine-1-carbonyl]anilino]cyclobut-3-ene-1,2-dione (PubChem CID 142857004) has the molecular formula C27H24N4O5S and a molecular weight of 516.58 g/mol. Its IUPAC name is 3-(benzylamino)-4-[2-hydroxy-3-[4-(thiophene-2-carbonyl)piperazine-1-carbonyl]anilino]cyclobut-3-ene-1,2-dione.
| Compound Name | 3-(benzylamino)-4-[2-hydroxy-3-[4-(thiophene-2-carbonyl)piperazine-1-carbonyl]anilino]cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 142857004 |
| Molecular Formula | C27H24N4O5S |
| Molecular Weight | 516.58 g/mol |
| Exact Mass | 516.15 |
| IUPAC Name | 3-(benzylamino)-4-[2-hydroxy-3-[4-(thiophene-2-carbonyl)piperazine-1-carbonyl]anilino]cyclobut-3-ene-1,2-dione |
| SMILES | O=C(c1cccs1)N1CCN(C(=O)c2cccc(Nc3c(NCc4ccccc4)c(=O)c3=O)c2O)CC1 |
| InChI | InChI=1S/C27H24N4O5S/c32-23-18(26(35)30-11-13-31(14-12-30)27(36)20-10-5-15-37-20)8-4-9-19(23)29-22-21(24(33)25(22)34)28-16-17-6-2-1-3-7-17/h1-10,15,28-29,32H,11-14,16H2 |
| InChIKey | SENXIIWZWPDFAO-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 119.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.58 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|