C24H29N3O4 — CID 142810285
3-(benzylamino)-2-[2-hydroxy-3-(3-hydroxypyrrolidine-1-carbonyl)anilino]cyclobut-2-en-1-one;ethane (PubChem CID 142810285) has the molecular formula C24H29N3O4 and a molecular weight of 423.51 g/mol. Its IUPAC name is 3-(benzylamino)-2-[2-hydroxy-3-(3-hydroxypyrrolidine-1-carbonyl)anilino]cyclobut-2-en-1-one;ethane.
| Compound Name | 3-(benzylamino)-2-[2-hydroxy-3-(3-hydroxypyrrolidine-1-carbonyl)anilino]cyclobut-2-en-1-one;ethane |
|---|---|
| PubChem CID | 142810285 |
| Molecular Formula | C24H29N3O4 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | 3-(benzylamino)-2-[2-hydroxy-3-(3-hydroxypyrrolidine-1-carbonyl)anilino]cyclobut-2-en-1-one;ethane |
| SMILES | CC.O=C1CC(NCc2ccccc2)=C1Nc1cccc(C(=O)N2CCC(O)C2)c1O |
| InChI | InChI=1S/C22H23N3O4.C2H6/c26-15-9-10-25(13-15)22(29)16-7-4-8-17(21(16)28)24-20-18(11-19(20)27)23-12-14-5-2-1-3-6-14;1-2/h1-8,15,23-24,26,28H,9-13H2;1-2H3 |
| InChIKey | OYUYMYRRVOQWHA-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|