C25H33N3O5 — CID 142810438
3-[[2-(benzylamino)-3-hydroxy-4-oxocyclobuten-1-yl]amino]-2-hydroxybenzaldehyde;ethane;1-methylpyrrolidin-3-ol (PubChem CID 142810438) has the molecular formula C25H33N3O5 and a molecular weight of 455.56 g/mol. Its IUPAC name is 3-[[2-(benzylamino)-3-hydroxy-4-oxocyclobuten-1-yl]amino]-2-hydroxybenzaldehyde;ethane;1-methylpyrrolidin-3-ol.
| Compound Name | 3-[[2-(benzylamino)-3-hydroxy-4-oxocyclobuten-1-yl]amino]-2-hydroxybenzaldehyde;ethane;1-methylpyrrolidin-3-ol |
|---|---|
| PubChem CID | 142810438 |
| Molecular Formula | C25H33N3O5 |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.24 |
| IUPAC Name | 3-[[2-(benzylamino)-3-hydroxy-4-oxocyclobuten-1-yl]amino]-2-hydroxybenzaldehyde;ethane;1-methylpyrrolidin-3-ol |
| SMILES | CC.CN1CCC(O)C1.O=Cc1cccc(NC2=C(NCc3ccccc3)C(O)C2=O)c1O |
| InChI | InChI=1S/C18H16N2O4.C5H11NO.C2H6/c21-10-12-7-4-8-13(16(12)22)20-15-14(17(23)18(15)24)19-9-11-5-2-1-3-6-11;1-6-3-2-5(7)4-6;1-2/h1-8,10,17,19-20,22-23H,9H2;5,7H,2-4H2,1H3;1-2H3 |
| InChIKey | UZUZGISAZPJXFV-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 122.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|