C23H27N3O4 — CID 142180399
3-(benzylamino)-2-[2-hydroxy-3-(3-hydroxyazetidine-1-carbonyl)anilino]cyclobut-2-en-1-one;ethane (PubChem CID 142180399) has the molecular formula C23H27N3O4 and a molecular weight of 409.49 g/mol. Its IUPAC name is 3-(benzylamino)-2-[2-hydroxy-3-(3-hydroxyazetidine-1-carbonyl)anilino]cyclobut-2-en-1-one;ethane.
| Compound Name | 3-(benzylamino)-2-[2-hydroxy-3-(3-hydroxyazetidine-1-carbonyl)anilino]cyclobut-2-en-1-one;ethane |
|---|---|
| PubChem CID | 142180399 |
| Molecular Formula | C23H27N3O4 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | 3-(benzylamino)-2-[2-hydroxy-3-(3-hydroxyazetidine-1-carbonyl)anilino]cyclobut-2-en-1-one;ethane |
| SMILES | CC.O=C1CC(NCc2ccccc2)=C1Nc1cccc(C(=O)N2CC(O)C2)c1O |
| InChI | InChI=1S/C21H21N3O4.C2H6/c25-14-11-24(12-14)21(28)15-7-4-8-16(20(15)27)23-19-17(9-18(19)26)22-10-13-5-2-1-3-6-13;1-2/h1-8,14,22-23,25,27H,9-12H2;1-2H3 |
| InChIKey | WRWTZKWNKIHALS-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|