C20H21N3O4 — CID 142180304
3-[[2-(benzylamino)-3,4-dioxocyclobuten-1-yl]amino]-2-hydroxybenzamide;ethane (PubChem CID 142180304) has the molecular formula C20H21N3O4 and a molecular weight of 367.41 g/mol. Its IUPAC name is 3-[[2-(benzylamino)-3,4-dioxocyclobuten-1-yl]amino]-2-hydroxybenzamide;ethane.
| Compound Name | 3-[[2-(benzylamino)-3,4-dioxocyclobuten-1-yl]amino]-2-hydroxybenzamide;ethane |
|---|---|
| PubChem CID | 142180304 |
| Molecular Formula | C20H21N3O4 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | 3-[[2-(benzylamino)-3,4-dioxocyclobuten-1-yl]amino]-2-hydroxybenzamide;ethane |
| SMILES | CC.NC(=O)c1cccc(Nc2c(NCc3ccccc3)c(=O)c2=O)c1O |
| InChI | InChI=1S/C18H15N3O4.C2H6/c19-18(25)11-7-4-8-12(15(11)22)21-14-13(16(23)17(14)24)20-9-10-5-2-1-3-6-10;1-2/h1-8,20-22H,9H2,(H2,19,25);1-2H3 |
| InChIKey | UPSLMZKWYFHFFG-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|