C22H27N5O4 — CID 142262625
3-[[4-(benzylamino)-2-methyl-3,6-dioxo-1H-pyridazin-5-yl]amino]-2-hydroxy-N-methylbenzamide;ethane (PubChem CID 142262625) has the molecular formula C22H27N5O4 and a molecular weight of 425.49 g/mol. Its IUPAC name is 3-[[4-(benzylamino)-2-methyl-3,6-dioxo-1H-pyridazin-5-yl]amino]-2-hydroxy-N-methylbenzamide;ethane.
| Compound Name | 3-[[4-(benzylamino)-2-methyl-3,6-dioxo-1H-pyridazin-5-yl]amino]-2-hydroxy-N-methylbenzamide;ethane |
|---|---|
| PubChem CID | 142262625 |
| Molecular Formula | C22H27N5O4 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | 3-[[4-(benzylamino)-2-methyl-3,6-dioxo-1H-pyridazin-5-yl]amino]-2-hydroxy-N-methylbenzamide;ethane |
| SMILES | CC.CNC(=O)c1cccc(Nc2c(NCc3ccccc3)c(=O)n(C)[nH]c2=O)c1O |
| InChI | InChI=1S/C20H21N5O4.C2H6/c1-21-18(27)13-9-6-10-14(17(13)26)23-15-16(20(29)25(2)24-19(15)28)22-11-12-7-4-3-5-8-12;1-2/h3-10,22-23,26H,11H2,1-2H3,(H,21,27)(H,24,28);1-2H3 |
| InChIKey | DITVOUCHCVCWJX-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 128.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|