C13H12BrN3O4 — CID 142262632
3-[(4-bromo-1-methyl-2,5-dioxopyrrol-3-yl)amino]-2-hydroxy-N-methylbenzamide (PubChem CID 142262632) has the molecular formula C13H12BrN3O4 and a molecular weight of 354.16 g/mol. Its IUPAC name is 3-[(4-bromo-1-methyl-2,5-dioxopyrrol-3-yl)amino]-2-hydroxy-N-methylbenzamide.
| Compound Name | 3-[(4-bromo-1-methyl-2,5-dioxopyrrol-3-yl)amino]-2-hydroxy-N-methylbenzamide |
|---|---|
| PubChem CID | 142262632 |
| Molecular Formula | C13H12BrN3O4 |
| Molecular Weight | 354.16 g/mol |
| Exact Mass | 353.00 |
| IUPAC Name | 3-[(4-bromo-1-methyl-2,5-dioxopyrrol-3-yl)amino]-2-hydroxy-N-methylbenzamide |
| SMILES | CNC(=O)c1cccc(NC2=C(Br)C(=O)N(C)C2=O)c1O |
| InChI | InChI=1S/C13H12BrN3O4/c1-15-11(19)6-4-3-5-7(10(6)18)16-9-8(14)12(20)17(2)13(9)21/h3-5,16,18H,1-2H3,(H,15,19) |
| InChIKey | BZUXHCJMHGIBKV-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.16 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|