C20H19F3N4O4S — CID 20795558
2-hydroxy-N,N-dimethyl-3-[[1-methyl-2,5-dioxo-4-[(2,2,2-trifluoro-1-thiophen-2-ylethyl)amino]pyrrol-3-yl]amino]benzamide (PubChem CID 20795558) has the molecular formula C20H19F3N4O4S and a molecular weight of 468.46 g/mol. Its IUPAC name is 2-hydroxy-N,N-dimethyl-3-[[1-methyl-2,5-dioxo-4-[(2,2,2-trifluoro-1-thiophen-2-ylethyl)amino]pyrrol-3-yl]amino]benzamide.
| Compound Name | 2-hydroxy-N,N-dimethyl-3-[[1-methyl-2,5-dioxo-4-[(2,2,2-trifluoro-1-thiophen-2-ylethyl)amino]pyrrol-3-yl]amino]benzamide |
|---|---|
| PubChem CID | 20795558 |
| Molecular Formula | C20H19F3N4O4S |
| Molecular Weight | 468.46 g/mol |
| Exact Mass | 468.11 |
| IUPAC Name | 2-hydroxy-N,N-dimethyl-3-[[1-methyl-2,5-dioxo-4-[(2,2,2-trifluoro-1-thiophen-2-ylethyl)amino]pyrrol-3-yl]amino]benzamide |
| SMILES | CN(C)C(=O)c1cccc(NC2=C(NC(c3cccs3)C(F)(F)F)C(=O)N(C)C2=O)c1O |
| InChI | InChI=1S/C20H19F3N4O4S/c1-26(2)17(29)10-6-4-7-11(15(10)28)24-13-14(19(31)27(3)18(13)30)25-16(20(21,22)23)12-8-5-9-32-12/h4-9,16,24-25,28H,1-3H3 |
| InChIKey | RMAAWCDAROBPIK-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 101.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.46 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|