C25H27F3N4O4S — CID 20795608
3-[[1-cyclohexyl-2,5-dioxo-4-[(2,2,2-trifluoro-1-thiophen-2-ylethyl)amino]pyrrol-3-yl]amino]-2-hydroxy-N,N-dimethylbenzamide (PubChem CID 20795608) has the molecular formula C25H27F3N4O4S and a molecular weight of 536.58 g/mol. Its IUPAC name is 3-[[1-cyclohexyl-2,5-dioxo-4-[(2,2,2-trifluoro-1-thiophen-2-ylethyl)amino]pyrrol-3-yl]amino]-2-hydroxy-N,N-dimethylbenzamide.
| Compound Name | 3-[[1-cyclohexyl-2,5-dioxo-4-[(2,2,2-trifluoro-1-thiophen-2-ylethyl)amino]pyrrol-3-yl]amino]-2-hydroxy-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 20795608 |
| Molecular Formula | C25H27F3N4O4S |
| Molecular Weight | 536.58 g/mol |
| Exact Mass | 536.17 |
| IUPAC Name | 3-[[1-cyclohexyl-2,5-dioxo-4-[(2,2,2-trifluoro-1-thiophen-2-ylethyl)amino]pyrrol-3-yl]amino]-2-hydroxy-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1cccc(NC2=C(NC(c3cccs3)C(F)(F)F)C(=O)N(C3CCCCC3)C2=O)c1O |
| InChI | InChI=1S/C25H27F3N4O4S/c1-31(2)22(34)15-10-6-11-16(20(15)33)29-18-19(30-21(25(26,27)28)17-12-7-13-37-17)24(36)32(23(18)35)14-8-4-3-5-9-14/h6-7,10-14,21,29-30,33H,3-5,8-9H2,1-2H3 |
| InChIKey | SYEKSGXNDWOQFQ-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 101.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.58 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|