C20H23N3O4S — CID 142180226
2-hydroxy-N,N-dimethyl-3-(methylamino)benzamide;3-[[(1R)-1-thiophen-2-ylethyl]amino]cyclobut-3-ene-1,2-dione (PubChem CID 142180226) has the molecular formula C20H23N3O4S and a molecular weight of 401.49 g/mol. Its IUPAC name is 2-hydroxy-N,N-dimethyl-3-(methylamino)benzamide;3-[[(1R)-1-thiophen-2-ylethyl]amino]cyclobut-3-ene-1,2-dione.
| Compound Name | 2-hydroxy-N,N-dimethyl-3-(methylamino)benzamide;3-[[(1R)-1-thiophen-2-ylethyl]amino]cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 142180226 |
| Molecular Formula | C20H23N3O4S |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | 2-hydroxy-N,N-dimethyl-3-(methylamino)benzamide;3-[[(1R)-1-thiophen-2-ylethyl]amino]cyclobut-3-ene-1,2-dione |
| SMILES | CNc1cccc(C(=O)N(C)C)c1O.C[C@@H](Nc1cc(=O)c1=O)c1cccs1 |
| InChI | InChI=1S/C10H14N2O2.C10H9NO2S/c1-11-8-6-4-5-7(9(8)13)10(14)12(2)3;1-6(9-3-2-4-14-9)11-7-5-8(12)10(7)13/h4-6,11,13H,1-3H3;2-6,11H,1H3/t;6-/m.1/s1 |
| InChIKey | XLDHKJSVPTVNOU-FCXZQVPUSA-N |
| XLogP | 2.65 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|