C19H20N3O4S+ — CID 142857032
[3-(dimethylcarbamoyl)-2-hydroxyphenyl]-[3,4-dioxo-2-[[(1R)-1-thiophen-2-ylethyl]amino]cyclobuten-1-yl]azanium (PubChem CID 142857032) has the molecular formula C19H20N3O4S+ and a molecular weight of 386.45 g/mol. Its IUPAC name is [3-(dimethylcarbamoyl)-2-hydroxyphenyl]-[3,4-dioxo-2-[[(1R)-1-thiophen-2-ylethyl]amino]cyclobuten-1-yl]azanium.
| Compound Name | [3-(dimethylcarbamoyl)-2-hydroxyphenyl]-[3,4-dioxo-2-[[(1R)-1-thiophen-2-ylethyl]amino]cyclobuten-1-yl]azanium |
|---|---|
| PubChem CID | 142857032 |
| Molecular Formula | C19H20N3O4S+ |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | [3-(dimethylcarbamoyl)-2-hydroxyphenyl]-[3,4-dioxo-2-[[(1R)-1-thiophen-2-ylethyl]amino]cyclobuten-1-yl]azanium |
| SMILES | C[C@@H](Nc1c([NH2+]c2cccc(C(=O)N(C)C)c2O)c(=O)c1=O)c1cccs1 |
| InChI | InChI=1S/C19H19N3O4S/c1-10(13-8-5-9-27-13)20-14-15(18(25)17(14)24)21-12-7-4-6-11(16(12)23)19(26)22(2)3/h4-10,20-21,23H,1-3H3/p+1/t10-/m1/s1 |
| InChIKey | RHEMNXGPTWMSDI-SNVBAGLBSA-O |
| XLogP | 1.45 |
| TPSA | 103.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|