C12H11N3O4 — CID 142233998
2-hydroxy-3-[(4-methyl-2,5-dioxopyrrol-3-yl)amino]benzamide (PubChem CID 142233998) has the molecular formula C12H11N3O4 and a molecular weight of 261.24 g/mol. Its IUPAC name is 2-hydroxy-3-[(4-methyl-2,5-dioxopyrrol-3-yl)amino]benzamide.
| Compound Name | 2-hydroxy-3-[(4-methyl-2,5-dioxopyrrol-3-yl)amino]benzamide |
|---|---|
| PubChem CID | 142233998 |
| Molecular Formula | C12H11N3O4 |
| Molecular Weight | 261.24 g/mol |
| Exact Mass | 261.07 |
| IUPAC Name | 2-hydroxy-3-[(4-methyl-2,5-dioxopyrrol-3-yl)amino]benzamide |
| SMILES | CC1=C(Nc2cccc(C(N)=O)c2O)C(=O)NC1=O |
| InChI | InChI=1S/C12H11N3O4/c1-5-8(12(19)15-11(5)18)14-7-4-2-3-6(9(7)16)10(13)17/h2-4,16H,1H3,(H2,13,17)(H2,14,15,18,19) |
| InChIKey | DIMKVOBKPVWMRA-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.24 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|