C21H23N5O4 — CID 59996654
2-hydroxy-3-[[2-methyl-3,6-dioxo-5-[[(1R)-1-phenylpropyl]amino]-1H-pyridazin-4-yl]amino]benzamide (PubChem CID 59996654) has the molecular formula C21H23N5O4 and a molecular weight of 409.45 g/mol. Its IUPAC name is 2-hydroxy-3-[[2-methyl-3,6-dioxo-5-[[(1R)-1-phenylpropyl]amino]-1H-pyridazin-4-yl]amino]benzamide.
| Compound Name | 2-hydroxy-3-[[2-methyl-3,6-dioxo-5-[[(1R)-1-phenylpropyl]amino]-1H-pyridazin-4-yl]amino]benzamide |
|---|---|
| PubChem CID | 59996654 |
| Molecular Formula | C21H23N5O4 |
| Molecular Weight | 409.45 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | 2-hydroxy-3-[[2-methyl-3,6-dioxo-5-[[(1R)-1-phenylpropyl]amino]-1H-pyridazin-4-yl]amino]benzamide |
| SMILES | CC[C@@H](Nc1c(Nc2cccc(C(N)=O)c2O)c(=O)n(C)[nH]c1=O)c1ccccc1 |
| InChI | InChI=1S/C21H23N5O4/c1-3-14(12-8-5-4-6-9-12)23-16-17(21(30)26(2)25-20(16)29)24-15-11-7-10-13(18(15)27)19(22)28/h4-11,14,23-24,27H,3H2,1-2H3,(H2,22,28)(H,25,29)/t14-/m1/s1 |
| InChIKey | FBOZWLGRGFRIDW-CQSZACIVSA-N |
| XLogP | 2.18 |
| TPSA | 142.24 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.45 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|