C23H27N5O4 — CID 59996704
3-[[2-ethyl-3,6-dioxo-5-[[(1R)-1-phenylpropyl]amino]-1H-pyridazin-4-yl]amino]-2-hydroxy-N-methylbenzamide (PubChem CID 59996704) has the molecular formula C23H27N5O4 and a molecular weight of 437.50 g/mol. Its IUPAC name is 3-[[2-ethyl-3,6-dioxo-5-[[(1R)-1-phenylpropyl]amino]-1H-pyridazin-4-yl]amino]-2-hydroxy-N-methylbenzamide.
| Compound Name | 3-[[2-ethyl-3,6-dioxo-5-[[(1R)-1-phenylpropyl]amino]-1H-pyridazin-4-yl]amino]-2-hydroxy-N-methylbenzamide |
|---|---|
| PubChem CID | 59996704 |
| Molecular Formula | C23H27N5O4 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.21 |
| IUPAC Name | 3-[[2-ethyl-3,6-dioxo-5-[[(1R)-1-phenylpropyl]amino]-1H-pyridazin-4-yl]amino]-2-hydroxy-N-methylbenzamide |
| SMILES | CC[C@@H](Nc1c(Nc2cccc(C(=O)NC)c2O)c(=O)n(CC)[nH]c1=O)c1ccccc1 |
| InChI | InChI=1S/C23H27N5O4/c1-4-16(14-10-7-6-8-11-14)25-18-19(23(32)28(5-2)27-22(18)31)26-17-13-9-12-15(20(17)29)21(30)24-3/h6-13,16,25-26,29H,4-5H2,1-3H3,(H,24,30)(H,27,31)/t16-/m1/s1 |
| InChIKey | GQWGSIBYQRFGDW-MRXNPFEDSA-N |
| XLogP | 2.93 |
| TPSA | 128.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|