C28H32N2O6 — CID 58418488
tert-butyl 5-[3-[[3,4-dioxo-2-[[(1R)-1-phenylpropyl]amino]cyclobuten-1-yl]amino]-2-hydroxyphenyl]-5-oxopentanoate (PubChem CID 58418488) has the molecular formula C28H32N2O6 and a molecular weight of 492.57 g/mol. Its IUPAC name is tert-butyl 5-[3-[[3,4-dioxo-2-[[(1R)-1-phenylpropyl]amino]cyclobuten-1-yl]amino]-2-hydroxyphenyl]-5-oxopentanoate.
| Compound Name | tert-butyl 5-[3-[[3,4-dioxo-2-[[(1R)-1-phenylpropyl]amino]cyclobuten-1-yl]amino]-2-hydroxyphenyl]-5-oxopentanoate |
|---|---|
| PubChem CID | 58418488 |
| Molecular Formula | C28H32N2O6 |
| Molecular Weight | 492.57 g/mol |
| Exact Mass | 492.23 |
| IUPAC Name | tert-butyl 5-[3-[[3,4-dioxo-2-[[(1R)-1-phenylpropyl]amino]cyclobuten-1-yl]amino]-2-hydroxyphenyl]-5-oxopentanoate |
| SMILES | CC[C@@H](Nc1c(Nc2cccc(C(=O)CCCC(=O)OC(C)(C)C)c2O)c(=O)c1=O)c1ccccc1 |
| InChI | InChI=1S/C28H32N2O6/c1-5-19(17-11-7-6-8-12-17)29-23-24(27(35)26(23)34)30-20-14-9-13-18(25(20)33)21(31)15-10-16-22(32)36-28(2,3)4/h6-9,11-14,19,29-30,33H,5,10,15-16H2,1-4H3/t19-/m1/s1 |
| InChIKey | WHBQELRSFRZBNT-LJQANCHMSA-N |
| XLogP | 4.99 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.57 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|