C19H19N3O3 — CID 75283274
3-[(3-hydroxy-2-methyl-4-pyridinyl)amino]-4-(1-phenylpropylamino)cyclobut-3-ene-1,2-dione (PubChem CID 75283274) has the molecular formula C19H19N3O3 and a molecular weight of 337.38 g/mol. Its IUPAC name is 3-[(3-hydroxy-2-methyl-4-pyridinyl)amino]-4-(1-phenylpropylamino)cyclobut-3-ene-1,2-dione.
| Compound Name | 3-[(3-hydroxy-2-methyl-4-pyridinyl)amino]-4-(1-phenylpropylamino)cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 75283274 |
| Molecular Formula | C19H19N3O3 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | 3-[(3-hydroxy-2-methyl-4-pyridinyl)amino]-4-(1-phenylpropylamino)cyclobut-3-ene-1,2-dione |
| SMILES | CCC(Nc1c(Nc2ccnc(C)c2O)c(=O)c1=O)c1ccccc1 |
| InChI | InChI=1S/C19H19N3O3/c1-3-13(12-7-5-4-6-8-12)21-15-16(19(25)18(15)24)22-14-9-10-20-11(2)17(14)23/h4-10,13,21,23H,3H2,1-2H3,(H,20,22) |
| InChIKey | KLRFQCGELWNDSZ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|