C28H29N3O5 — CID 142180570
2-(dimethylamino)phenol;3-[[3,4-dioxo-2-[[(1R)-1-phenylpropyl]amino]cyclobuten-1-yl]amino]-2-hydroxybenzaldehyde (PubChem CID 142180570) has the molecular formula C28H29N3O5 and a molecular weight of 487.56 g/mol. Its IUPAC name is 2-(dimethylamino)phenol;3-[[3,4-dioxo-2-[[(1R)-1-phenylpropyl]amino]cyclobuten-1-yl]amino]-2-hydroxybenzaldehyde.
| Compound Name | 2-(dimethylamino)phenol;3-[[3,4-dioxo-2-[[(1R)-1-phenylpropyl]amino]cyclobuten-1-yl]amino]-2-hydroxybenzaldehyde |
|---|---|
| PubChem CID | 142180570 |
| Molecular Formula | C28H29N3O5 |
| Molecular Weight | 487.56 g/mol |
| Exact Mass | 487.21 |
| IUPAC Name | 2-(dimethylamino)phenol;3-[[3,4-dioxo-2-[[(1R)-1-phenylpropyl]amino]cyclobuten-1-yl]amino]-2-hydroxybenzaldehyde |
| SMILES | CC[C@@H](Nc1c(Nc2cccc(C=O)c2O)c(=O)c1=O)c1ccccc1.CN(C)c1ccccc1O |
| InChI | InChI=1S/C20H18N2O4.C8H11NO/c1-2-14(12-7-4-3-5-8-12)21-16-17(20(26)19(16)25)22-15-10-6-9-13(11-23)18(15)24;1-9(2)7-5-3-4-6-8(7)10/h3-11,14,21-22,24H,2H2,1H3;3-6,10H,1-2H3/t14-;/m1./s1 |
| InChIKey | BOVYSAAUPJEOJD-PFEQFJNWSA-N |
| XLogP | 4.57 |
| TPSA | 118.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.56 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|