C29H31N5O4 — CID 20772629
3-[[2-benzyl-3,6-dioxo-5-(1-phenylpropylamino)-1H-pyridazin-4-yl]amino]-2-hydroxy-N,N-dimethylbenzamide (PubChem CID 20772629) has the molecular formula C29H31N5O4 and a molecular weight of 513.60 g/mol. Its IUPAC name is 3-[[2-benzyl-3,6-dioxo-5-(1-phenylpropylamino)-1H-pyridazin-4-yl]amino]-2-hydroxy-N,N-dimethylbenzamide.
| Compound Name | 3-[[2-benzyl-3,6-dioxo-5-(1-phenylpropylamino)-1H-pyridazin-4-yl]amino]-2-hydroxy-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 20772629 |
| Molecular Formula | C29H31N5O4 |
| Molecular Weight | 513.60 g/mol |
| Exact Mass | 513.24 |
| IUPAC Name | 3-[[2-benzyl-3,6-dioxo-5-(1-phenylpropylamino)-1H-pyridazin-4-yl]amino]-2-hydroxy-N,N-dimethylbenzamide |
| SMILES | CCC(Nc1c(Nc2cccc(C(=O)N(C)C)c2O)c(=O)n(Cc2ccccc2)[nH]c1=O)c1ccccc1 |
| InChI | InChI=1S/C29H31N5O4/c1-4-22(20-14-9-6-10-15-20)30-24-25(31-23-17-11-16-21(26(23)35)28(37)33(2)3)29(38)34(32-27(24)36)18-19-12-7-5-8-13-19/h5-17,22,30-31,35H,4,18H2,1-3H3,(H,32,36) |
| InChIKey | NHINVJKHNFLIOG-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 119.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.60 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|