C25H30N6O4 — CID 142262552
3-[[5-(benzylamino)-2-ethyl-3,6-dioxo-1H-pyridazin-4-yl]amino]-5-cyano-2-hydroxy-N,N-dimethylbenzamide;ethane (PubChem CID 142262552) has the molecular formula C25H30N6O4 and a molecular weight of 478.55 g/mol. Its IUPAC name is 3-[[5-(benzylamino)-2-ethyl-3,6-dioxo-1H-pyridazin-4-yl]amino]-5-cyano-2-hydroxy-N,N-dimethylbenzamide;ethane.
| Compound Name | 3-[[5-(benzylamino)-2-ethyl-3,6-dioxo-1H-pyridazin-4-yl]amino]-5-cyano-2-hydroxy-N,N-dimethylbenzamide;ethane |
|---|---|
| PubChem CID | 142262552 |
| Molecular Formula | C25H30N6O4 |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.23 |
| IUPAC Name | 3-[[5-(benzylamino)-2-ethyl-3,6-dioxo-1H-pyridazin-4-yl]amino]-5-cyano-2-hydroxy-N,N-dimethylbenzamide;ethane |
| SMILES | CC.CCn1[nH]c(=O)c(NCc2ccccc2)c(Nc2cc(C#N)cc(C(=O)N(C)C)c2O)c1=O |
| InChI | InChI=1S/C23H24N6O4.C2H6/c1-4-29-23(33)19(18(21(31)27-29)25-13-14-8-6-5-7-9-14)26-17-11-15(12-24)10-16(20(17)30)22(32)28(2)3;1-2/h5-11,25-26,30H,4,13H2,1-3H3,(H,27,31);1-2H3 |
| InChIKey | DXRCHOPCPHXMES-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 143.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|