C20H20N3O4+ — CID 163604763
[3-[[2-(benzylamino)-3,4-dioxocyclobuten-1-yl]amino]-2-hydroxybenzoyl]-dimethylazanium (PubChem CID 163604763) has the molecular formula C20H20N3O4+ and a molecular weight of 366.40 g/mol. Its IUPAC name is [3-[[2-(benzylamino)-3,4-dioxocyclobuten-1-yl]amino]-2-hydroxybenzoyl]-dimethylazanium.
| Compound Name | [3-[[2-(benzylamino)-3,4-dioxocyclobuten-1-yl]amino]-2-hydroxybenzoyl]-dimethylazanium |
|---|---|
| PubChem CID | 163604763 |
| Molecular Formula | C20H20N3O4+ |
| Molecular Weight | 366.40 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | [3-[[2-(benzylamino)-3,4-dioxocyclobuten-1-yl]amino]-2-hydroxybenzoyl]-dimethylazanium |
| SMILES | C[NH+](C)C(=O)c1cccc(Nc2c(NCc3ccccc3)c(=O)c2=O)c1O |
| InChI | InChI=1S/C20H19N3O4/c1-23(2)20(27)13-9-6-10-14(17(13)24)22-16-15(18(25)19(16)26)21-11-12-7-4-3-5-8-12/h3-10,21-22,24H,11H2,1-2H3/p+1 |
| InChIKey | HATZRSBFZYTSOM-UHFFFAOYSA-O |
| XLogP | 0.63 |
| TPSA | 99.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.40 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|