C23H26ClN3O3S — CID 142531857
3-(benzylamino)-4-[4-chloro-3-(dimethylaminosulfanyl)-2-hydroxyanilino]cyclobut-3-ene-1,2-dione;cyclobutane (PubChem CID 142531857) has the molecular formula C23H26ClN3O3S and a molecular weight of 460.00 g/mol. Its IUPAC name is 3-(benzylamino)-4-[4-chloro-3-(dimethylaminosulfanyl)-2-hydroxyanilino]cyclobut-3-ene-1,2-dione;cyclobutane.
| Compound Name | 3-(benzylamino)-4-[4-chloro-3-(dimethylaminosulfanyl)-2-hydroxyanilino]cyclobut-3-ene-1,2-dione;cyclobutane |
|---|---|
| PubChem CID | 142531857 |
| Molecular Formula | C23H26ClN3O3S |
| Molecular Weight | 460.00 g/mol |
| Exact Mass | 459.14 |
| IUPAC Name | 3-(benzylamino)-4-[4-chloro-3-(dimethylaminosulfanyl)-2-hydroxyanilino]cyclobut-3-ene-1,2-dione;cyclobutane |
| SMILES | C1CCC1.CN(C)Sc1c(Cl)ccc(Nc2c(NCc3ccccc3)c(=O)c2=O)c1O |
| InChI | InChI=1S/C19H18ClN3O3S.C4H8/c1-23(2)27-19-12(20)8-9-13(16(19)24)22-15-14(17(25)18(15)26)21-10-11-6-4-3-5-7-11;1-2-4-3-1/h3-9,21-22,24H,10H2,1-2H3;1-4H2 |
| InChIKey | SXZLDAHOMHUDDL-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.00 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|