C20H20ClN3O6S — CID 44629059
6-chloro-3-[[3,4-dioxo-2-[[(1R)-1-phenylethyl]amino]cyclobuten-1-yl]amino]-2-hydroxy-N-methoxy-N-methylbenzenesulfonamide (PubChem CID 44629059) has the molecular formula C20H20ClN3O6S and a molecular weight of 465.92 g/mol. Its IUPAC name is 6-chloro-3-[[3,4-dioxo-2-[[(1R)-1-phenylethyl]amino]cyclobuten-1-yl]amino]-2-hydroxy-N-methoxy-N-methylbenzenesulfonamide.
| Compound Name | 6-chloro-3-[[3,4-dioxo-2-[[(1R)-1-phenylethyl]amino]cyclobuten-1-yl]amino]-2-hydroxy-N-methoxy-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 44629059 |
| Molecular Formula | C20H20ClN3O6S |
| Molecular Weight | 465.92 g/mol |
| Exact Mass | 465.08 |
| IUPAC Name | 6-chloro-3-[[3,4-dioxo-2-[[(1R)-1-phenylethyl]amino]cyclobuten-1-yl]amino]-2-hydroxy-N-methoxy-N-methylbenzenesulfonamide |
| SMILES | CON(C)S(=O)(=O)c1c(Cl)ccc(Nc2c(N[C@H](C)c3ccccc3)c(=O)c2=O)c1O |
| InChI | InChI=1S/C20H20ClN3O6S/c1-11(12-7-5-4-6-8-12)22-15-16(19(27)18(15)26)23-14-10-9-13(21)20(17(14)25)31(28,29)24(2)30-3/h4-11,22-23,25H,1-3H3/t11-/m1/s1 |
| InChIKey | HMJPEQOBHMGCOJ-LLVKDONJSA-N |
| XLogP | 2.74 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.92 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|