C17H22ClN3O8S — CID 59178032
6-chloro-3-[[2-(1,3-dimethoxypropan-2-ylamino)-3,4-dioxocyclobuten-1-yl]amino]-2-hydroxy-N-methoxy-N-methylbenzenesulfonamide (PubChem CID 59178032) has the molecular formula C17H22ClN3O8S and a molecular weight of 463.90 g/mol. Its IUPAC name is 6-chloro-3-[[2-(1,3-dimethoxypropan-2-ylamino)-3,4-dioxocyclobuten-1-yl]amino]-2-hydroxy-N-methoxy-N-methylbenzenesulfonamide.
| Compound Name | 6-chloro-3-[[2-(1,3-dimethoxypropan-2-ylamino)-3,4-dioxocyclobuten-1-yl]amino]-2-hydroxy-N-methoxy-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 59178032 |
| Molecular Formula | C17H22ClN3O8S |
| Molecular Weight | 463.90 g/mol |
| Exact Mass | 463.08 |
| IUPAC Name | 6-chloro-3-[[2-(1,3-dimethoxypropan-2-ylamino)-3,4-dioxocyclobuten-1-yl]amino]-2-hydroxy-N-methoxy-N-methylbenzenesulfonamide |
| SMILES | COCC(COC)Nc1c(Nc2ccc(Cl)c(S(=O)(=O)N(C)OC)c2O)c(=O)c1=O |
| InChI | InChI=1S/C17H22ClN3O8S/c1-21(29-4)30(25,26)17-10(18)5-6-11(14(17)22)20-13-12(15(23)16(13)24)19-9(7-27-2)8-28-3/h5-6,9,19-20,22H,7-8H2,1-4H3 |
| InChIKey | IOCNSDVLYOZDEQ-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 143.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.90 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|