C20H29ClN4O4S — CID 121438074
3-[4-chloro-3-[N-[2-(dimethylamino)ethyl]-S-methylsulfonimidoyl]-2-hydroxyanilino]-4-(pentan-3-ylamino)cyclobut-3-ene-1,2-dione (PubChem CID 121438074) has the molecular formula C20H29ClN4O4S and a molecular weight of 457.00 g/mol. Its IUPAC name is 3-[4-chloro-3-[N-[2-(dimethylamino)ethyl]-S-methylsulfonimidoyl]-2-hydroxyanilino]-4-(pentan-3-ylamino)cyclobut-3-ene-1,2-dione.
| Compound Name | 3-[4-chloro-3-[N-[2-(dimethylamino)ethyl]-S-methylsulfonimidoyl]-2-hydroxyanilino]-4-(pentan-3-ylamino)cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 121438074 |
| Molecular Formula | C20H29ClN4O4S |
| Molecular Weight | 457.00 g/mol |
| Exact Mass | 456.16 |
| IUPAC Name | 3-[4-chloro-3-[N-[2-(dimethylamino)ethyl]-S-methylsulfonimidoyl]-2-hydroxyanilino]-4-(pentan-3-ylamino)cyclobut-3-ene-1,2-dione |
| SMILES | CCC(CC)Nc1c(Nc2ccc(Cl)c(S(C)(=O)=NCCN(C)C)c2O)c(=O)c1=O |
| InChI | InChI=1S/C20H29ClN4O4S/c1-6-12(7-2)23-15-16(19(28)18(15)27)24-14-9-8-13(21)20(17(14)26)30(5,29)22-10-11-25(3)4/h8-9,12,23-24,26H,6-7,10-11H2,1-5H3 |
| InChIKey | TUPIBJFQHPZPII-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 111.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.00 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|