C17H22ClN3O5S — CID 137440236
3-[4-chloro-3-[N-[1-(dimethylamino)ethyl]-S-methylsulfonimidoyl]-2-hydroxyanilino]-4-ethoxycyclobut-3-ene-1,2-dione (PubChem CID 137440236) has the molecular formula C17H22ClN3O5S and a molecular weight of 415.90 g/mol. Its IUPAC name is 3-[4-chloro-3-[N-[1-(dimethylamino)ethyl]-S-methylsulfonimidoyl]-2-hydroxyanilino]-4-ethoxycyclobut-3-ene-1,2-dione.
| Compound Name | 3-[4-chloro-3-[N-[1-(dimethylamino)ethyl]-S-methylsulfonimidoyl]-2-hydroxyanilino]-4-ethoxycyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 137440236 |
| Molecular Formula | C17H22ClN3O5S |
| Molecular Weight | 415.90 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | 3-[4-chloro-3-[N-[1-(dimethylamino)ethyl]-S-methylsulfonimidoyl]-2-hydroxyanilino]-4-ethoxycyclobut-3-ene-1,2-dione |
| SMILES | CCOc1c(Nc2ccc(Cl)c(S(C)(=O)=NC(C)N(C)C)c2O)c(=O)c1=O |
| InChI | InChI=1S/C17H22ClN3O5S/c1-6-26-16-12(14(23)15(16)24)19-11-8-7-10(18)17(13(11)22)27(5,25)20-9(2)21(3)4/h7-9,19,22H,6H2,1-5H3 |
| InChIKey | FUGGAMALQYWVFQ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 108.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.90 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|