C22H28ClN3O7S — CID 59327356
3-(4-chloro-2-hydroxy-3-morpholin-4-ylsulfonylanilino)-4-[[(1R)-1-[(2R,5R)-5-methyloxolan-2-yl]propyl]amino]cyclobut-3-ene-1,2-dione (PubChem CID 59327356) has the molecular formula C22H28ClN3O7S and a molecular weight of 514.00 g/mol. Its IUPAC name is 3-(4-chloro-2-hydroxy-3-morpholin-4-ylsulfonylanilino)-4-[[(1R)-1-[(2R,5R)-5-methyloxolan-2-yl]propyl]amino]cyclobut-3-ene-1,2-dione.
| Compound Name | 3-(4-chloro-2-hydroxy-3-morpholin-4-ylsulfonylanilino)-4-[[(1R)-1-[(2R,5R)-5-methyloxolan-2-yl]propyl]amino]cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 59327356 |
| Molecular Formula | C22H28ClN3O7S |
| Molecular Weight | 514.00 g/mol |
| Exact Mass | 513.13 |
| IUPAC Name | 3-(4-chloro-2-hydroxy-3-morpholin-4-ylsulfonylanilino)-4-[[(1R)-1-[(2R,5R)-5-methyloxolan-2-yl]propyl]amino]cyclobut-3-ene-1,2-dione |
| SMILES | CC[C@@H](Nc1c(Nc2ccc(Cl)c(S(=O)(=O)N3CCOCC3)c2O)c(=O)c1=O)[C@H]1CC[C@@H](C)O1 |
| InChI | InChI=1S/C22H28ClN3O7S/c1-3-14(16-7-4-12(2)33-16)24-17-18(21(29)20(17)28)25-15-6-5-13(23)22(19(15)27)34(30,31)26-8-10-32-11-9-26/h5-6,12,14,16,24-25,27H,3-4,7-11H2,1-2H3/t12-,14-,16-/m1/s1 |
| InChIKey | KRIXBLIBZMVEQH-XNRPHZJLSA-N |
| XLogP | 2.16 |
| TPSA | 134.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.00 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|