C28H34ClN3O6S — CID 163709874
3-[3-(8-azaspiro[4.5]decan-8-ylsulfonyl)-4-chloro-2-hydroxyanilino]-4-[[(1R)-1-(5-methylfuran-2-yl)propyl]amino]-6-oxabicyclo[3.1.0]hex-3-en-2-one (PubChem CID 163709874) has the molecular formula C28H34ClN3O6S and a molecular weight of 576.12 g/mol. Its IUPAC name is 3-[3-(8-azaspiro[4.5]decan-8-ylsulfonyl)-4-chloro-2-hydroxyanilino]-4-[[(1R)-1-(5-methylfuran-2-yl)propyl]amino]-6-oxabicyclo[3.1.0]hex-3-en-2-one.
| Compound Name | 3-[3-(8-azaspiro[4.5]decan-8-ylsulfonyl)-4-chloro-2-hydroxyanilino]-4-[[(1R)-1-(5-methylfuran-2-yl)propyl]amino]-6-oxabicyclo[3.1.0]hex-3-en-2-one |
|---|---|
| PubChem CID | 163709874 |
| Molecular Formula | C28H34ClN3O6S |
| Molecular Weight | 576.12 g/mol |
| Exact Mass | 575.19 |
| IUPAC Name | 3-[3-(8-azaspiro[4.5]decan-8-ylsulfonyl)-4-chloro-2-hydroxyanilino]-4-[[(1R)-1-(5-methylfuran-2-yl)propyl]amino]-6-oxabicyclo[3.1.0]hex-3-en-2-one |
| SMILES | CC[C@@H](NC1=C(Nc2ccc(Cl)c(S(=O)(=O)N3CCC4(CCCC4)CC3)c2O)C(=O)C2OC12)c1ccc(C)o1 |
| InChI | InChI=1S/C28H34ClN3O6S/c1-3-18(20-9-6-16(2)37-20)30-22-21(24(34)26-25(22)38-26)31-19-8-7-17(29)27(23(19)33)39(35,36)32-14-12-28(13-15-32)10-4-5-11-28/h6-9,18,25-26,30-31,33H,3-5,10-15H2,1-2H3/t18-,25?,26?/m1/s1 |
| InChIKey | KIGLXCMHOILBAH-GTANCFNGSA-N |
| XLogP | 5.01 |
| TPSA | 124.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.12 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|