C20H25N5O5S — CID 135458366
2-[[4-[[(1R)-1-(5-methylfuran-2-yl)propyl]amino]-1,2,5-oxadiazol-3-yl]amino]-6-pyrrolidin-1-ylsulfonylphenol (PubChem CID 135458366) has the molecular formula C20H25N5O5S and a molecular weight of 447.52 g/mol. Its IUPAC name is 2-[[4-[[(1R)-1-(5-methylfuran-2-yl)propyl]amino]-1,2,5-oxadiazol-3-yl]amino]-6-pyrrolidin-1-ylsulfonylphenol.
| Compound Name | 2-[[4-[[(1R)-1-(5-methylfuran-2-yl)propyl]amino]-1,2,5-oxadiazol-3-yl]amino]-6-pyrrolidin-1-ylsulfonylphenol |
|---|---|
| PubChem CID | 135458366 |
| Molecular Formula | C20H25N5O5S |
| Molecular Weight | 447.52 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | 2-[[4-[[(1R)-1-(5-methylfuran-2-yl)propyl]amino]-1,2,5-oxadiazol-3-yl]amino]-6-pyrrolidin-1-ylsulfonylphenol |
| SMILES | CC[C@@H](Nc1nonc1Nc1cccc(S(=O)(=O)N2CCCC2)c1O)c1ccc(C)o1 |
| InChI | InChI=1S/C20H25N5O5S/c1-3-14(16-10-9-13(2)29-16)21-19-20(24-30-23-19)22-15-7-6-8-17(18(15)26)31(27,28)25-11-4-5-12-25/h6-10,14,26H,3-5,11-12H2,1-2H3,(H,21,23)(H,22,24)/t14-/m1/s1 |
| InChIKey | IVACOWJOOZRFGB-CQSZACIVSA-N |
| XLogP | 3.77 |
| TPSA | 133.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.52 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|