C21H25N5O5S — CID 135968066
2-[[2-oxido-4-[[(1R)-1-phenylpropyl]amino]-1,2,5-oxadiazol-2-ium-3-yl]amino]-6-pyrrolidin-1-ylsulfonylphenol (PubChem CID 135968066) has the molecular formula C21H25N5O5S and a molecular weight of 459.53 g/mol. Its IUPAC name is 2-[[2-oxido-4-[[(1R)-1-phenylpropyl]amino]-1,2,5-oxadiazol-2-ium-3-yl]amino]-6-pyrrolidin-1-ylsulfonylphenol.
| Compound Name | 2-[[2-oxido-4-[[(1R)-1-phenylpropyl]amino]-1,2,5-oxadiazol-2-ium-3-yl]amino]-6-pyrrolidin-1-ylsulfonylphenol |
|---|---|
| PubChem CID | 135968066 |
| Molecular Formula | C21H25N5O5S |
| Molecular Weight | 459.53 g/mol |
| Exact Mass | 459.16 |
| IUPAC Name | 2-[[2-oxido-4-[[(1R)-1-phenylpropyl]amino]-1,2,5-oxadiazol-2-ium-3-yl]amino]-6-pyrrolidin-1-ylsulfonylphenol |
| SMILES | CC[C@@H](Nc1no[n+]([O-])c1Nc1cccc(S(=O)(=O)N2CCCC2)c1O)c1ccccc1 |
| InChI | InChI=1S/C21H25N5O5S/c1-2-16(15-9-4-3-5-10-15)22-20-21(26(28)31-24-20)23-17-11-8-12-18(19(17)27)32(29,30)25-13-6-7-14-25/h3-5,8-12,16,23,27H,2,6-7,13-14H2,1H3,(H,22,24)/t16-/m1/s1 |
| InChIKey | OGTJNLPFNJJIQZ-MRXNPFEDSA-N |
| XLogP | 3.10 |
| TPSA | 134.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.53 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'} |
|---|